About 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid
2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid (PubChem CID 87090703) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid |
| PubChem CID | 87090703 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid |
| SMILES | C=CCC/C=C/CCN(C)CCC(=C)C(=O)O |
| InChI | InChI=1S/C14H23NO2/c1-4-5-6-7-8-9-11-15(3)12-10-13(2)14(16)17/h4,7-8H,1-2,5-6,9-12H2,3H3,(H,16,17)/b8-7+ |
| InChIKey | LVAFPVRBDVIACZ-BQYQJAHWSA-N |
| XLogP | 2.86 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid?
The IUPAC name of 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid (CID 87090703) is 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid.
What is the SMILES notation for 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid?
The canonical SMILES for 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid is C=CCC/C=C/CCN(C)CCC(=C)C(=O)O.
What is the InChIKey of 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid?
The InChIKey is LVAFPVRBDVIACZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C14H23NO2/c1-4-5-6-7-8-9-11-15(3)12-10-13(2)14(16)17/h4,7-8H,1-2,5-6,9-12H2,3H3,(H,16,17)/b8-7+.
What are the key properties of 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid?
2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid has a molecular weight of 237.34 g/mol, XLogP of 2.86, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-4-[methyl-[(3E)-octa-3,7-dienyl]amino]butanoic acid is sourced from PubChem (CID 87090703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).