About (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine
(2Z)-N-methyl-N-propylocta-2,7-dien-2-amine (PubChem CID 87090710) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine |
| PubChem CID | 87090710 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine |
| SMILES | C=CCCC/C=C(/C)N(C)CCC |
| InChI | InChI=1S/C12H23N/c1-5-7-8-9-10-12(3)13(4)11-6-2/h5,10H,1,6-9,11H2,2-4H3/b12-10- |
| InChIKey | BSEUOPUBEMVUJR-BENRWUELSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine?
The IUPAC name of (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine (CID 87090710) is (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine.
What is the SMILES notation for (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine?
The canonical SMILES for (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine is C=CCCC/C=C(/C)N(C)CCC.
What is the InChIKey of (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine?
The InChIKey is BSEUOPUBEMVUJR-BENRWUELSA-N. The full InChI is InChI=1S/C12H23N/c1-5-7-8-9-10-12(3)13(4)11-6-2/h5,10H,1,6-9,11H2,2-4H3/b12-10-.
What are the key properties of (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine?
(2Z)-N-methyl-N-propylocta-2,7-dien-2-amine has a molecular weight of 181.32 g/mol, XLogP of 3.59, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-N-methyl-N-propylocta-2,7-dien-2-amine is sourced from PubChem (CID 87090710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).