C26H24F3N5O3S — CID 87091106
3-[2-(4-cyanoanilino)-2-oxoethoxy]-N-[(6S)-6-(3,3,3-trifluoropropylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide (PubChem CID 87091106) has the molecular formula C26H24F3N5O3S and a molecular weight of 543.57 g/mol. Its IUPAC name is 3-[2-(4-cyanoanilino)-2-oxoethoxy]-N-[(6S)-6-(3,3,3-trifluoropropylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide.
| Compound Name | 3-[2-(4-cyanoanilino)-2-oxoethoxy]-N-[(6S)-6-(3,3,3-trifluoropropylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 87091106 |
| Molecular Formula | C26H24F3N5O3S |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 3-[2-(4-cyanoanilino)-2-oxoethoxy]-N-[(6S)-6-(3,3,3-trifluoropropylamino)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]benzamide |
| SMILES | N#Cc1ccc(NC(=O)COc2cccc(C(=O)Nc3nc4c(s3)C[C@@H](NCCC(F)(F)F)CC4)c2)cc1 |
| InChI | InChI=1S/C26H24F3N5O3S/c27-26(28,29)10-11-31-19-8-9-21-22(13-19)38-25(33-21)34-24(36)17-2-1-3-20(12-17)37-15-23(35)32-18-6-4-16(14-30)5-7-18/h1-7,12,19,31H,8-11,13,15H2,(H,32,35)(H,33,34,36)/t19-/m0/s1 |
| InChIKey | UGJKHEPAJCKSQK-IBGZPJMESA-N |
| XLogP | 4.68 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |