C26H48O7 — CID 87091261
ethene;[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (Z)-octadec-9-enoate (PubChem CID 87091261) has the molecular formula C26H48O7 and a molecular weight of 472.66 g/mol. Its IUPAC name is ethene;[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (Z)-octadec-9-enoate.
| Compound Name | ethene;[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 87091261 |
| Molecular Formula | C26H48O7 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | ethene;[(3R,4S,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl] (Z)-octadec-9-enoate |
| SMILES | C=C.CCCCCCCC/C=C\CCCCCCCC(=O)OCC(=O)[C@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C24H44O7.C2H4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(28)31-19-21(27)24(30)23(29)20(26)18-25;1-2/h9-10,20,23-26,29-30H,2-8,11-19H2,1H3;1-2H2/b10-9-;/t20-,23+,24+;/m1./s1 |
| InChIKey | JUHBDINYUHHSFV-XZFBULPMSA-N |
| XLogP | 4.01 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|