C26H25ClN2O4S — CID 87091604
2-[2-[2-[benzyl(methoxy)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]-4-chlorophenoxy]acetic acid (PubChem CID 87091604) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is 2-[2-[2-[benzyl(methoxy)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]-4-chlorophenoxy]acetic acid.
| Compound Name | 2-[2-[2-[benzyl(methoxy)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]-4-chlorophenoxy]acetic acid |
|---|---|
| PubChem CID | 87091604 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 2-[2-[2-[benzyl(methoxy)carbamothioyl]-3,4-dihydro-1H-isoquinolin-1-yl]-4-chlorophenoxy]acetic acid |
| SMILES | CON(Cc1ccccc1)C(=S)N1CCc2ccccc2C1c1cc(Cl)ccc1OCC(=O)O |
| InChI | InChI=1S/C26H25ClN2O4S/c1-32-29(16-18-7-3-2-4-8-18)26(34)28-14-13-19-9-5-6-10-21(19)25(28)22-15-20(27)11-12-23(22)33-17-24(30)31/h2-12,15,25H,13-14,16-17H2,1H3,(H,30,31) |
| InChIKey | DDNDTTVNQDGQDA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|