About 2H-xanthene-1,8-dione
2H-xanthene-1,8-dione (PubChem CID 87091738) has the molecular formula C13H8O3
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2H-xanthene-1,8-dione.
Molecular Properties
| Compound Name | 2H-xanthene-1,8-dione |
| PubChem CID | 87091738 |
| Molecular Formula | C13H8O3 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | 2H-xanthene-1,8-dione |
| SMILES | O=C1CC=Cc2oc3cccc(=O)c-3cc21 |
| InChI | InChI=1S/C13H8O3/c14-10-3-1-5-12-8(10)7-9-11(15)4-2-6-13(9)16-12/h1-3,5-7H,4H2 |
| InChIKey | OCSDTRKMSXQROF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-xanthene-1,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-xanthene-1,8-dione?
The IUPAC name of 2H-xanthene-1,8-dione (CID 87091738) is 2H-xanthene-1,8-dione.
What is the SMILES notation for 2H-xanthene-1,8-dione?
The canonical SMILES for 2H-xanthene-1,8-dione is O=C1CC=Cc2oc3cccc(=O)c-3cc21.
What is the InChIKey of 2H-xanthene-1,8-dione?
The InChIKey is OCSDTRKMSXQROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8O3/c14-10-3-1-5-12-8(10)7-9-11(15)4-2-6-13(9)16-12/h1-3,5-7H,4H2.
What are the key properties of 2H-xanthene-1,8-dione?
2H-xanthene-1,8-dione has a molecular weight of 212.20 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-xanthene-1,8-dione is sourced from PubChem (CID 87091738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).