C26H24F3NO5 — CID 87091837
(2,2,2-trifluoroacetyl) 3-[6-[(E)-3-phenylprop-2-enoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate (PubChem CID 87091837) has the molecular formula C26H24F3NO5 and a molecular weight of 487.47 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[6-[(E)-3-phenylprop-2-enoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[6-[(E)-3-phenylprop-2-enoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
|---|---|
| PubChem CID | 87091837 |
| Molecular Formula | C26H24F3NO5 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[6-[(E)-3-phenylprop-2-enoyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
| SMILES | O=C(CCN1CCC2(CC1)COc1cc(C(=O)/C=C/c3ccccc3)ccc12)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C26H24F3NO5/c27-26(28,29)24(33)35-23(32)10-13-30-14-11-25(12-15-30)17-34-22-16-19(7-8-20(22)25)21(31)9-6-18-4-2-1-3-5-18/h1-9,16H,10-15,17H2/b9-6+ |
| InChIKey | GWBBATFUKCQMQF-RMKNXTFCSA-N |
| XLogP | 4.33 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|