C8H4F8O — CID 87092096
4,5,5,6,6-pentafluoro-1-(trifluoromethyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 87092096) has the molecular formula C8H4F8O and a molecular weight of 268.10 g/mol. Its IUPAC name is 4,5,5,6,6-pentafluoro-1-(trifluoromethyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | 4,5,5,6,6-pentafluoro-1-(trifluoromethyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 87092096 |
| Molecular Formula | C8H4F8O |
| Molecular Weight | 268.10 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 4,5,5,6,6-pentafluoro-1-(trifluoromethyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | O=C1CC2(F)CC1(C(F)(F)F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C8H4F8O/c9-4-1-3(17)5(2-4,8(14,15)16)7(12,13)6(4,10)11/h1-2H2 |
| InChIKey | ZUYWHBQKGFQPQX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.10 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|