About N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide
N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide (PubChem CID 87092130) has the molecular formula C15H13NO3
and a molecular weight of 255.27 g/mol. Its IUPAC name is N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide.
Molecular Properties
| Compound Name | N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide |
| PubChem CID | 87092130 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide |
| SMILES | O=CNc1ccccc1C1COc2ccc(O)cc21 |
| InChI | InChI=1S/C15H13NO3/c17-9-16-14-4-2-1-3-11(14)13-8-19-15-6-5-10(18)7-12(13)15/h1-7,9,13,18H,8H2,(H,16,17) |
| InChIKey | LYUCKAORGDTSHR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide?
The IUPAC name of N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide (CID 87092130) is N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide.
What is the SMILES notation for N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide?
The canonical SMILES for N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide is O=CNc1ccccc1C1COc2ccc(O)cc21.
What is the InChIKey of N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide?
The InChIKey is LYUCKAORGDTSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3/c17-9-16-14-4-2-1-3-11(14)13-8-19-15-6-5-10(18)7-12(13)15/h1-7,9,13,18H,8H2,(H,16,17).
What are the key properties of N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide?
N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide has a molecular weight of 255.27 g/mol, XLogP of 2.48, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(5-hydroxy-2,3-dihydro-1-benzofuran-3-yl)phenyl]formamide is sourced from PubChem (CID 87092130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).