About propane-1-sulfonate;tetramethylazanium
propane-1-sulfonate;tetramethylazanium (PubChem CID 87092541) has the molecular formula C7H19NO3S
and a molecular weight of 197.30 g/mol. Its IUPAC name is propane-1-sulfonate;tetramethylazanium.
Molecular Properties
| Compound Name | propane-1-sulfonate;tetramethylazanium |
| PubChem CID | 87092541 |
| Molecular Formula | C7H19NO3S |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | propane-1-sulfonate;tetramethylazanium |
| SMILES | CCCS(=O)(=O)[O-].C[N+](C)(C)C |
| InChI | InChI=1S/C4H12N.C3H8O3S/c1-5(2,3)4;1-2-3-7(4,5)6/h1-4H3;2-3H2,1H3,(H,4,5,6)/q+1;/p-1 |
| InChIKey | VYTDODYLDLXYQA-UHFFFAOYSA-M |
| XLogP | 0.26 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze propane-1-sulfonate;tetramethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1-sulfonate;tetramethylazanium?
The IUPAC name of propane-1-sulfonate;tetramethylazanium (CID 87092541) is propane-1-sulfonate;tetramethylazanium.
What is the SMILES notation for propane-1-sulfonate;tetramethylazanium?
The canonical SMILES for propane-1-sulfonate;tetramethylazanium is CCCS(=O)(=O)[O-].C[N+](C)(C)C.
What is the InChIKey of propane-1-sulfonate;tetramethylazanium?
The InChIKey is VYTDODYLDLXYQA-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H12N.C3H8O3S/c1-5(2,3)4;1-2-3-7(4,5)6/h1-4H3;2-3H2,1H3,(H,4,5,6)/q+1;/p-1.
What are the key properties of propane-1-sulfonate;tetramethylazanium?
propane-1-sulfonate;tetramethylazanium has a molecular weight of 197.30 g/mol, XLogP of 0.26, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1-sulfonate;tetramethylazanium is sourced from PubChem (CID 87092541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).