About ethanesulfonic acid;tetrahexylazanium
ethanesulfonic acid;tetrahexylazanium (PubChem CID 87092635) has the molecular formula C26H58NO3S+
and a molecular weight of 464.82 g/mol. Its IUPAC name is ethanesulfonic acid;tetrahexylazanium.
Molecular Properties
| Compound Name | ethanesulfonic acid;tetrahexylazanium |
| PubChem CID | 87092635 |
| Molecular Formula | C26H58NO3S+ |
| Molecular Weight | 464.82 g/mol |
| Exact Mass | 464.41 |
| IUPAC Name | ethanesulfonic acid;tetrahexylazanium |
| SMILES | CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.CCS(=O)(=O)O |
| InChI | InChI=1S/C24H52N.C2H6O3S/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-2-6(3,4)5/h5-24H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1; |
| InChIKey | CQDNGKBWHGXRQW-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.82 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethanesulfonic acid;tetrahexylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanesulfonic acid;tetrahexylazanium?
The IUPAC name of ethanesulfonic acid;tetrahexylazanium (CID 87092635) is ethanesulfonic acid;tetrahexylazanium.
What is the SMILES notation for ethanesulfonic acid;tetrahexylazanium?
The canonical SMILES for ethanesulfonic acid;tetrahexylazanium is CCCCCC[N+](CCCCCC)(CCCCCC)CCCCCC.CCS(=O)(=O)O.
What is the InChIKey of ethanesulfonic acid;tetrahexylazanium?
The InChIKey is CQDNGKBWHGXRQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H52N.C2H6O3S/c1-5-9-13-17-21-25(22-18-14-10-6-2,23-19-15-11-7-3)24-20-16-12-8-4;1-2-6(3,4)5/h5-24H2,1-4H3;2H2,1H3,(H,3,4,5)/q+1;.
What are the key properties of ethanesulfonic acid;tetrahexylazanium?
ethanesulfonic acid;tetrahexylazanium has a molecular weight of 464.82 g/mol, XLogP of 8.02, 21 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanesulfonic acid;tetrahexylazanium is sourced from PubChem (CID 87092635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).