About N-ethylhydroxylamine;2-methylprop-2-enoic acid
N-ethylhydroxylamine;2-methylprop-2-enoic acid (PubChem CID 87092788) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is N-ethylhydroxylamine;2-methylprop-2-enoic acid.
Molecular Properties
| Compound Name | N-ethylhydroxylamine;2-methylprop-2-enoic acid |
| PubChem CID | 87092788 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | N-ethylhydroxylamine;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCNO |
| InChI | InChI=1S/C4H6O2.C2H7NO/c1-3(2)4(5)6;1-2-3-4/h1H2,2H3,(H,5,6);3-4H,2H2,1H3 |
| InChIKey | FJEVUZDIHODXON-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethylhydroxylamine;2-methylprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylhydroxylamine;2-methylprop-2-enoic acid?
The IUPAC name of N-ethylhydroxylamine;2-methylprop-2-enoic acid (CID 87092788) is N-ethylhydroxylamine;2-methylprop-2-enoic acid.
What is the SMILES notation for N-ethylhydroxylamine;2-methylprop-2-enoic acid?
The canonical SMILES for N-ethylhydroxylamine;2-methylprop-2-enoic acid is C=C(C)C(=O)O.CCNO.
What is the InChIKey of N-ethylhydroxylamine;2-methylprop-2-enoic acid?
The InChIKey is FJEVUZDIHODXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H7NO/c1-3(2)4(5)6;1-2-3-4/h1H2,2H3,(H,5,6);3-4H,2H2,1H3.
What are the key properties of N-ethylhydroxylamine;2-methylprop-2-enoic acid?
N-ethylhydroxylamine;2-methylprop-2-enoic acid has a molecular weight of 147.17 g/mol, XLogP of 0.63, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylhydroxylamine;2-methylprop-2-enoic acid is sourced from PubChem (CID 87092788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).