C20H33FO2S — CID 87092813
(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1-sulfonyl fluoride (PubChem CID 87092813) has the molecular formula C20H33FO2S and a molecular weight of 356.55 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1-sulfonyl fluoride.
| Compound Name | (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1-sulfonyl fluoride |
|---|---|
| PubChem CID | 87092813 |
| Molecular Formula | C20H33FO2S |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraene-1-sulfonyl fluoride |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CS(=O)(=O)F |
| InChI | InChI=1S/C20H33FO2S/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-24(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3/b18-11+,19-13+,20-15+ |
| InChIKey | LRNRHVPDGQYYMI-QIRCYJPOSA-N |
| XLogP | 6.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|