C20H33FO2S — CID 87092814
(6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfonyl fluoride (PubChem CID 87092814) has the molecular formula C20H33FO2S and a molecular weight of 356.55 g/mol. Its IUPAC name is (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfonyl fluoride.
| Compound Name | (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfonyl fluoride |
|---|---|
| PubChem CID | 87092814 |
| Molecular Formula | C20H33FO2S |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | (6E,10E)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraene-8-sulfonyl fluoride |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)S(=O)(=O)F |
| InChI | InChI=1S/C20H33FO2S/c1-16(2)9-7-11-18(5)13-14-20(24(21,22)23)15-19(6)12-8-10-17(3)4/h9-10,13,15,20H,7-8,11-12,14H2,1-6H3/b18-13+,19-15+ |
| InChIKey | DYTWYDKPFBPZPO-HQSZAHFGSA-N |
| XLogP | 6.43 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|