About 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane
6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane (PubChem CID 87093085) has the molecular formula C11H21NO5Si
and a molecular weight of 275.38 g/mol. Its IUPAC name is 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane.
Molecular Properties
| Compound Name | 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane |
| PubChem CID | 87093085 |
| Molecular Formula | C11H21NO5Si |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane |
| SMILES | COC1(CCCN=C=O)CCC[Si](OC)(OC)O1 |
| InChI | InChI=1S/C11H21NO5Si/c1-14-11(6-4-8-12-10-13)7-5-9-18(15-2,16-3)17-11/h4-9H2,1-3H3 |
| InChIKey | MARKOZABTOXNJE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane?
The IUPAC name of 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane (CID 87093085) is 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane.
What is the SMILES notation for 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane?
The canonical SMILES for 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane is COC1(CCCN=C=O)CCC[Si](OC)(OC)O1.
What is the InChIKey of 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane?
The InChIKey is MARKOZABTOXNJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO5Si/c1-14-11(6-4-8-12-10-13)7-5-9-18(15-2,16-3)17-11/h4-9H2,1-3H3.
What are the key properties of 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane?
6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane has a molecular weight of 275.38 g/mol, XLogP of 1.49, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-isocyanatopropyl)-2,2,6-trimethoxyoxasilinane is sourced from PubChem (CID 87093085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).