About (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene
(Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene (PubChem CID 87093138) has the molecular formula C6H5F7
and a molecular weight of 210.09 g/mol. Its IUPAC name is (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene.
Analyze (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene?
The IUPAC name of (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene (CID 87093138) is (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene.
What is the SMILES notation for (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene?
The canonical SMILES for (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene is CC(/C=C(\F)C(F)(F)F)C(F)(F)F.
What is the InChIKey of (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene?
The InChIKey is HHDLUXLBJXTFHQ-RQOWECAXSA-N. The full InChI is InChI=1S/C6H5F7/c1-3(5(8,9)10)2-4(7)6(11,12)13/h2-3H,1H3/b4-2-.
What are the key properties of (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene?
(Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene has a molecular weight of 210.09 g/mol, XLogP of 3.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,1,2,5,5,5-heptafluoro-4-methylpent-2-ene is sourced from PubChem (CID 87093138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).