About 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde
1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde (PubChem CID 87093711) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde.
Molecular Properties
| Compound Name | 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde |
| PubChem CID | 87093711 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde |
| SMILES | Cc1ccccc1Oc1ccccc1C.O=CC1CO1 |
| InChI | InChI=1S/C14H14O.C3H4O2/c1-11-7-3-5-9-13(11)15-14-10-6-4-8-12(14)2;4-1-3-2-5-3/h3-10H,1-2H3;1,3H,2H2 |
| InChIKey | AMGKMVKTXBODEM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde?
The IUPAC name of 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde (CID 87093711) is 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde.
What is the SMILES notation for 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde?
The canonical SMILES for 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde is Cc1ccccc1Oc1ccccc1C.O=CC1CO1.
What is the InChIKey of 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde?
The InChIKey is AMGKMVKTXBODEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O.C3H4O2/c1-11-7-3-5-9-13(11)15-14-10-6-4-8-12(14)2;4-1-3-2-5-3/h3-10H,1-2H3;1,3H,2H2.
What are the key properties of 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde?
1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde has a molecular weight of 270.33 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(2-methylphenoxy)benzene;oxirane-2-carbaldehyde is sourced from PubChem (CID 87093711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).