C16H26O12 — CID 87093750
acetic acid;[(2R,3S,4R)-4,5-diacetyloxy-3-(2-methoxyethylperoxy)oxolan-2-yl]methyl acetate (PubChem CID 87093750) has the molecular formula C16H26O12 and a molecular weight of 410.37 g/mol. Its IUPAC name is acetic acid;[(2R,3S,4R)-4,5-diacetyloxy-3-(2-methoxyethylperoxy)oxolan-2-yl]methyl acetate.
| Compound Name | acetic acid;[(2R,3S,4R)-4,5-diacetyloxy-3-(2-methoxyethylperoxy)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 87093750 |
| Molecular Formula | C16H26O12 |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | acetic acid;[(2R,3S,4R)-4,5-diacetyloxy-3-(2-methoxyethylperoxy)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)O.COCCOO[C@H]1[C@@H](COC(C)=O)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H22O10.C2H4O2/c1-8(15)19-7-11-12(24-20-6-5-18-4)13(21-9(2)16)14(23-11)22-10(3)17;1-2(3)4/h11-14H,5-7H2,1-4H3;1H3,(H,3,4)/t11-,12+,13-,14?;/m1./s1 |
| InChIKey | SJPJFNIWRDWJOU-JHUIPURMSA-N |
| XLogP | -0.18 |
| TPSA | 153.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|