About disodium;[(Z)-octadec-9-enyl] phosphate
disodium;[(Z)-octadec-9-enyl] phosphate (PubChem CID 87093817) has the molecular formula C18H35Na2O4P
and a molecular weight of 392.43 g/mol. Its IUPAC name is disodium;[(Z)-octadec-9-enyl] phosphate.
Molecular Properties
| Compound Name | disodium;[(Z)-octadec-9-enyl] phosphate |
| PubChem CID | 87093817 |
| Molecular Formula | C18H35Na2O4P |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | disodium;[(Z)-octadec-9-enyl] phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C18H37O4P.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-23(19,20)21;;/h9-10H,2-8,11-18H2,1H3,(H2,19,20,21);;/q;2*+1/p-2/b10-9-;; |
| InChIKey | KLJJISMFFCYLQO-XXAVUKJNSA-L |
| XLogP | -1.12 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;[(Z)-octadec-9-enyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;[(Z)-octadec-9-enyl] phosphate?
The IUPAC name of disodium;[(Z)-octadec-9-enyl] phosphate (CID 87093817) is disodium;[(Z)-octadec-9-enyl] phosphate.
What is the SMILES notation for disodium;[(Z)-octadec-9-enyl] phosphate?
The canonical SMILES for disodium;[(Z)-octadec-9-enyl] phosphate is CCCCCCCC/C=C\CCCCCCCCOP(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;[(Z)-octadec-9-enyl] phosphate?
The InChIKey is KLJJISMFFCYLQO-XXAVUKJNSA-L. The full InChI is InChI=1S/C18H37O4P.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-23(19,20)21;;/h9-10H,2-8,11-18H2,1H3,(H2,19,20,21);;/q;2*+1/p-2/b10-9-;;.
What are the key properties of disodium;[(Z)-octadec-9-enyl] phosphate?
disodium;[(Z)-octadec-9-enyl] phosphate has a molecular weight of 392.43 g/mol, XLogP of -1.12, 17 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;[(Z)-octadec-9-enyl] phosphate is sourced from PubChem (CID 87093817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).