About hydroxy-oxo-propylphosphanium;zinc
hydroxy-oxo-propylphosphanium;zinc (PubChem CID 87094262) has the molecular formula C3H8O2PZn+
and a molecular weight of 172.46 g/mol. Its IUPAC name is hydroxy-oxo-propylphosphanium;zinc.
Molecular Properties
| Compound Name | hydroxy-oxo-propylphosphanium;zinc |
| PubChem CID | 87094262 |
| Molecular Formula | C3H8O2PZn+ |
| Molecular Weight | 172.46 g/mol |
| Exact Mass | 170.95 |
| IUPAC Name | hydroxy-oxo-propylphosphanium;zinc |
| SMILES | CCC[P+](=O)O.[Zn] |
| InChI | InChI=1S/C3H7O2P.Zn/c1-2-3-6(4)5;/h2-3H2,1H3;/p+1 |
| InChIKey | UYVDCOKIIAWVEO-UHFFFAOYSA-O |
| XLogP | 1.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.46 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-oxo-propylphosphanium;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-oxo-propylphosphanium;zinc?
The IUPAC name of hydroxy-oxo-propylphosphanium;zinc (CID 87094262) is hydroxy-oxo-propylphosphanium;zinc.
What is the SMILES notation for hydroxy-oxo-propylphosphanium;zinc?
The canonical SMILES for hydroxy-oxo-propylphosphanium;zinc is CCC[P+](=O)O.[Zn].
What is the InChIKey of hydroxy-oxo-propylphosphanium;zinc?
The InChIKey is UYVDCOKIIAWVEO-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7O2P.Zn/c1-2-3-6(4)5;/h2-3H2,1H3;/p+1.
What are the key properties of hydroxy-oxo-propylphosphanium;zinc?
hydroxy-oxo-propylphosphanium;zinc has a molecular weight of 172.46 g/mol, XLogP of 1.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-oxo-propylphosphanium;zinc is sourced from PubChem (CID 87094262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).