C54H78P2 — CID 87094403
ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;dicyclohexyl-(2-methyl-3-phenylphenyl)phosphane (PubChem CID 87094403) has the molecular formula C54H78P2 and a molecular weight of 789.17 g/mol. Its IUPAC name is ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;dicyclohexyl-(2-methyl-3-phenylphenyl)phosphane.
| Compound Name | ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;dicyclohexyl-(2-methyl-3-phenylphenyl)phosphane |
|---|---|
| PubChem CID | 87094403 |
| Molecular Formula | C54H78P2 |
| Molecular Weight | 789.17 g/mol |
| Exact Mass | 788.56 |
| IUPAC Name | ditert-butyl-[2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphane;dicyclohexyl-(2-methyl-3-phenylphenyl)phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2ccccc2P(C(C)(C)C)C(C)(C)C)c(C(C)C)c1.Cc1c(-c2ccccc2)cccc1P(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C29H45P.C25H33P/c1-19(2)22-17-24(20(3)4)27(25(18-22)21(5)6)23-15-13-14-16-26(23)30(28(7,8)9)29(10,11)12;1-20-24(21-12-5-2-6-13-21)18-11-19-25(20)26(22-14-7-3-8-15-22)23-16-9-4-10-17-23/h13-21H,1-12H3;2,5-6,11-13,18-19,22-23H,3-4,7-10,14-17H2,1H3 |
| InChIKey | KOGRMVONTAZRPK-UHFFFAOYSA-N |
| XLogP | 16.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.17 |
| LogP ≤ 5 | 16.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|