C24H27N3O8S3 — CID 87094550
2,5-dioxo-1-[6-[[2-[1-(pyridin-2-yldisulfanyl)ethyl]benzoyl]amino]hexanoyloxy]pyrrolidine-3-sulfonic acid (PubChem CID 87094550) has the molecular formula C24H27N3O8S3 and a molecular weight of 581.69 g/mol. Its IUPAC name is 2,5-dioxo-1-[6-[[2-[1-(pyridin-2-yldisulfanyl)ethyl]benzoyl]amino]hexanoyloxy]pyrrolidine-3-sulfonic acid.
| Compound Name | 2,5-dioxo-1-[6-[[2-[1-(pyridin-2-yldisulfanyl)ethyl]benzoyl]amino]hexanoyloxy]pyrrolidine-3-sulfonic acid |
|---|---|
| PubChem CID | 87094550 |
| Molecular Formula | C24H27N3O8S3 |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.10 |
| IUPAC Name | 2,5-dioxo-1-[6-[[2-[1-(pyridin-2-yldisulfanyl)ethyl]benzoyl]amino]hexanoyloxy]pyrrolidine-3-sulfonic acid |
| SMILES | CC(SSc1ccccn1)c1ccccc1C(=O)NCCCCCC(=O)ON1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C24H27N3O8S3/c1-16(36-37-20-11-6-8-13-25-20)17-9-4-5-10-18(17)23(30)26-14-7-2-3-12-22(29)35-27-21(28)15-19(24(27)31)38(32,33)34/h4-6,8-11,13,16,19H,2-3,7,12,14-15H2,1H3,(H,26,30)(H,32,33,34) |
| InChIKey | IIRFMIKBXCMIPE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 160.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|