About tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate
tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate (PubChem CID 87094814) has the molecular formula C15H17ClN2O4
and a molecular weight of 324.76 g/mol. Its IUPAC name is tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate |
| PubChem CID | 87094814 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(C1)OC(=O)c1cnc(Cl)cc12 |
| InChI | InChI=1S/C15H17ClN2O4/c1-14(2,3)22-13(20)18-5-4-15(8-18)10-6-11(16)17-7-9(10)12(19)21-15/h6-7H,4-5,8H2,1-3H3 |
| InChIKey | MLNWJJZUEFWYMX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate?
The IUPAC name of tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate (CID 87094814) is tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate.
What is the SMILES notation for tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate?
The canonical SMILES for tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate is CC(C)(C)OC(=O)N1CCC2(C1)OC(=O)c1cnc(Cl)cc12.
What is the InChIKey of tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate?
The InChIKey is MLNWJJZUEFWYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClN2O4/c1-14(2,3)22-13(20)18-5-4-15(8-18)10-6-11(16)17-7-9(10)12(19)21-15/h6-7H,4-5,8H2,1-3H3.
What are the key properties of tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate?
tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate has a molecular weight of 324.76 g/mol, XLogP of 2.74, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-chloro-3-oxospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-1'-carboxylate is sourced from PubChem (CID 87094814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).