C34H53P — CID 87094998
2,2,6,6-tetramethyl-1-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphinane (PubChem CID 87094998) has the molecular formula C34H53P and a molecular weight of 492.77 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphinane.
| Compound Name | 2,2,6,6-tetramethyl-1-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphinane |
|---|---|
| PubChem CID | 87094998 |
| Molecular Formula | C34H53P |
| Molecular Weight | 492.77 g/mol |
| Exact Mass | 492.39 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-[2,3,4,5-tetramethyl-6-[2,4,6-tri(propan-2-yl)phenyl]phenyl]phosphinane |
| SMILES | Cc1c(C)c(C)c(P2C(C)(C)CCCC2(C)C)c(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)c1C |
| InChI | InChI=1S/C34H53P/c1-20(2)27-18-28(21(3)4)31(29(19-27)22(5)6)30-25(9)23(7)24(8)26(10)32(30)35-33(11,12)16-15-17-34(35,13)14/h18-22H,15-17H2,1-14H3 |
| InChIKey | FMAKALPMQOMXNB-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.77 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|