C22H23F6N5O5S — CID 87095098
[(3R,4R)-4-methyl-3-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87095098) has the molecular formula C22H23F6N5O5S and a molecular weight of 583.51 g/mol. Its IUPAC name is [(3R,4R)-4-methyl-3-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [(3R,4R)-4-methyl-3-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87095098 |
| Molecular Formula | C22H23F6N5O5S |
| Molecular Weight | 583.51 g/mol |
| Exact Mass | 583.13 |
| IUPAC Name | [(3R,4R)-4-methyl-3-[methyl(1H-pyrrolo[2,3-b]pyridin-4-yl)amino]piperidin-1-yl]-(1,3-thiazol-4-yl)methanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C[C@@H]1CCN(C(=O)c2cscn2)C[C@@H]1N(C)c1ccnc2[nH]ccc12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N5OS.2C2HF3O2/c1-12-5-8-23(18(24)14-10-25-11-21-14)9-16(12)22(2)15-4-7-20-17-13(15)3-6-19-17;2*3-2(4,5)1(6)7/h3-4,6-7,10-12,16H,5,8-9H2,1-2H3,(H,19,20);2*(H,6,7)/t12-,16+;;/m1../s1 |
| InChIKey | MBQNRHATBBIFAI-JCTZKOOHSA-N |
| XLogP | 4.27 |
| TPSA | 139.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |