About 2-[methyl(octa-3,7-dienyl)amino]ethanol
2-[methyl(octa-3,7-dienyl)amino]ethanol (PubChem CID 87095310) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-[methyl(octa-3,7-dienyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl(octa-3,7-dienyl)amino]ethanol |
| PubChem CID | 87095310 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-[methyl(octa-3,7-dienyl)amino]ethanol |
| SMILES | C=CCCC=CCCN(C)CCO |
| InChI | InChI=1S/C11H21NO/c1-3-4-5-6-7-8-9-12(2)10-11-13/h3,6-7,13H,1,4-5,8-11H2,2H3 |
| InChIKey | VFEWHYGRRYMUMB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[methyl(octa-3,7-dienyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl(octa-3,7-dienyl)amino]ethanol?
The IUPAC name of 2-[methyl(octa-3,7-dienyl)amino]ethanol (CID 87095310) is 2-[methyl(octa-3,7-dienyl)amino]ethanol.
What is the SMILES notation for 2-[methyl(octa-3,7-dienyl)amino]ethanol?
The canonical SMILES for 2-[methyl(octa-3,7-dienyl)amino]ethanol is C=CCCC=CCCN(C)CCO.
What is the InChIKey of 2-[methyl(octa-3,7-dienyl)amino]ethanol?
The InChIKey is VFEWHYGRRYMUMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-3-4-5-6-7-8-9-12(2)10-11-13/h3,6-7,13H,1,4-5,8-11H2,2H3.
What are the key properties of 2-[methyl(octa-3,7-dienyl)amino]ethanol?
2-[methyl(octa-3,7-dienyl)amino]ethanol has a molecular weight of 183.29 g/mol, XLogP of 1.82, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl(octa-3,7-dienyl)amino]ethanol is sourced from PubChem (CID 87095310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).