About azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene
azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene (PubChem CID 87095456) has the molecular formula C18H15Br2N3
and a molecular weight of 433.15 g/mol. Its IUPAC name is azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene.
Molecular Properties
| Compound Name | azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene |
| PubChem CID | 87095456 |
| Molecular Formula | C18H15Br2N3 |
| Molecular Weight | 433.15 g/mol |
| Exact Mass | 430.96 |
| IUPAC Name | azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene |
| SMILES | Brc1cc(Br)c(/N=N/c2ccccc2)c(-c2ccccc2)c1.N |
| InChI | InChI=1S/C18H12Br2N2.H3N/c19-14-11-16(13-7-3-1-4-8-13)18(17(20)12-14)22-21-15-9-5-2-6-10-15;/h1-12H;1H3/b22-21+; |
| InChIKey | RAQAVYOCZIXJKO-QUABFQRHSA-N |
| XLogP | 7.46 |
| TPSA | 59.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.15 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene?
The IUPAC name of azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene (CID 87095456) is azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene.
What is the SMILES notation for azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene?
The canonical SMILES for azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene is Brc1cc(Br)c(/N=N/c2ccccc2)c(-c2ccccc2)c1.N.
What is the InChIKey of azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene?
The InChIKey is RAQAVYOCZIXJKO-QUABFQRHSA-N. The full InChI is InChI=1S/C18H12Br2N2.H3N/c19-14-11-16(13-7-3-1-4-8-13)18(17(20)12-14)22-21-15-9-5-2-6-10-15;/h1-12H;1H3/b22-21+;.
What are the key properties of azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene?
azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene has a molecular weight of 433.15 g/mol, XLogP of 7.46, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2,4-dibromo-6-phenylphenyl)-phenyldiazene is sourced from PubChem (CID 87095456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).