C18H11F3N2O6 — CID 87095471
[3-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] 2,2,2-trifluoroacetate (PubChem CID 87095471) has the molecular formula C18H11F3N2O6 and a molecular weight of 408.29 g/mol. Its IUPAC name is [3-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87095471 |
| Molecular Formula | C18H11F3N2O6 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [3-[(3-hydroxyquinoline-2-carbonyl)amino]-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(NC1=CC(=O)C2OC2C1OC(=O)C(F)(F)F)c1nc2ccccc2cc1O |
| InChI | InChI=1S/C18H11F3N2O6/c19-18(20,21)17(27)29-13-9(6-11(25)14-15(13)28-14)23-16(26)12-10(24)5-7-3-1-2-4-8(7)22-12/h1-6,13-15,24H,(H,23,26) |
| InChIKey | XSTXHUXLVBRBBT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|