About 2-[ethyl(octa-4,7-dienyl)amino]ethanol
2-[ethyl(octa-4,7-dienyl)amino]ethanol (PubChem CID 87095556) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-[ethyl(octa-4,7-dienyl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[ethyl(octa-4,7-dienyl)amino]ethanol |
| PubChem CID | 87095556 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-[ethyl(octa-4,7-dienyl)amino]ethanol |
| SMILES | C=CCC=CCCCN(CC)CCO |
| InChI | InChI=1S/C12H23NO/c1-3-5-6-7-8-9-10-13(4-2)11-12-14/h3,6-7,14H,1,4-5,8-12H2,2H3 |
| InChIKey | DARBOYQRBYZMHS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[ethyl(octa-4,7-dienyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl(octa-4,7-dienyl)amino]ethanol?
The IUPAC name of 2-[ethyl(octa-4,7-dienyl)amino]ethanol (CID 87095556) is 2-[ethyl(octa-4,7-dienyl)amino]ethanol.
What is the SMILES notation for 2-[ethyl(octa-4,7-dienyl)amino]ethanol?
The canonical SMILES for 2-[ethyl(octa-4,7-dienyl)amino]ethanol is C=CCC=CCCCN(CC)CCO.
What is the InChIKey of 2-[ethyl(octa-4,7-dienyl)amino]ethanol?
The InChIKey is DARBOYQRBYZMHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-3-5-6-7-8-9-10-13(4-2)11-12-14/h3,6-7,14H,1,4-5,8-12H2,2H3.
What are the key properties of 2-[ethyl(octa-4,7-dienyl)amino]ethanol?
2-[ethyl(octa-4,7-dienyl)amino]ethanol has a molecular weight of 197.32 g/mol, XLogP of 2.21, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl(octa-4,7-dienyl)amino]ethanol is sourced from PubChem (CID 87095556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).