About 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol
1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol (PubChem CID 87095577) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol.
Molecular Properties
| Compound Name | 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol |
| PubChem CID | 87095577 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol |
| SMILES | CCC/C=C/C=C/CN(CC)C(C)O |
| InChI | InChI=1S/C12H23NO/c1-4-6-7-8-9-10-11-13(5-2)12(3)14/h7-10,12,14H,4-6,11H2,1-3H3/b8-7+,10-9+ |
| InChIKey | SZCLDVYFDILXNO-XBLVEGMJSA-N |
| XLogP | 2.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol?
The IUPAC name of 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol (CID 87095577) is 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol.
What is the SMILES notation for 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol?
The canonical SMILES for 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol is CCC/C=C/C=C/CN(CC)C(C)O.
What is the InChIKey of 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol?
The InChIKey is SZCLDVYFDILXNO-XBLVEGMJSA-N. The full InChI is InChI=1S/C12H23NO/c1-4-6-7-8-9-10-11-13(5-2)12(3)14/h7-10,12,14H,4-6,11H2,1-3H3/b8-7+,10-9+.
What are the key properties of 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol?
1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol has a molecular weight of 197.32 g/mol, XLogP of 2.56, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[ethyl-[(2E,4E)-octa-2,4-dienyl]amino]ethanol is sourced from PubChem (CID 87095577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).