C11H22N2 — CID 87095667
2-ethyl-1-methyl-1-[(2E)-octa-2,7-dienyl]hydrazine (PubChem CID 87095667) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethyl-1-methyl-1-[(2E)-octa-2,7-dienyl]hydrazine.
| Compound Name | 2-ethyl-1-methyl-1-[(2E)-octa-2,7-dienyl]hydrazine |
|---|---|
| PubChem CID | 87095667 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-ethyl-1-methyl-1-[(2E)-octa-2,7-dienyl]hydrazine |
| SMILES | C=CCCC/C=C/CN(C)NCC |
| InChI | InChI=1S/C11H22N2/c1-4-6-7-8-9-10-11-13(3)12-5-2/h4,9-10,12H,1,5-8,11H2,2-3H3/b10-9+ |
| InChIKey | XUDRNXGZZFFFIO-MDZDMXLPSA-N |
| XLogP | 2.36 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|