C10H16F4N2O3S — CID 87095946
(1-butyl-3-methyl-2H-imidazol-2-yl) 1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 87095946) has the molecular formula C10H16F4N2O3S and a molecular weight of 320.31 g/mol. Its IUPAC name is (1-butyl-3-methyl-2H-imidazol-2-yl) 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | (1-butyl-3-methyl-2H-imidazol-2-yl) 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 87095946 |
| Molecular Formula | C10H16F4N2O3S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (1-butyl-3-methyl-2H-imidazol-2-yl) 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | CCCCN1C=CN(C)C1OS(=O)(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4N2O3S/c1-3-4-5-16-7-6-15(2)9(16)19-20(17,18)10(13,14)8(11)12/h6-9H,3-5H2,1-2H3 |
| InChIKey | JEHJRWHJDUFZRO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|