About 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile
4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile (PubChem CID 87096098) has the molecular formula C7H3ClN4
and a molecular weight of 178.58 g/mol. Its IUPAC name is 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile.
Molecular Properties
| Compound Name | 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile |
| PubChem CID | 87096098 |
| Molecular Formula | C7H3ClN4 |
| Molecular Weight | 178.58 g/mol |
| Exact Mass | 178.00 |
| IUPAC Name | 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile |
| SMILES | N#Cc1ccc2c(Cl)ncnn12 |
| InChI | InChI=1S/C7H3ClN4/c8-7-6-2-1-5(3-9)12(6)11-4-10-7/h1-2,4H |
| InChIKey | XEZYQDQRLVLVIW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.58 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile?
The IUPAC name of 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile (CID 87096098) is 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile.
What is the SMILES notation for 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile?
The canonical SMILES for 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile is N#Cc1ccc2c(Cl)ncnn12.
What is the InChIKey of 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile?
The InChIKey is XEZYQDQRLVLVIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3ClN4/c8-7-6-2-1-5(3-9)12(6)11-4-10-7/h1-2,4H.
What are the key properties of 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile?
4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile has a molecular weight of 178.58 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloropyrrolo[2,1-f][1,2,4]triazine-7-carbonitrile is sourced from PubChem (CID 87096098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).