About 3-methoxybutylhydrazine
3-methoxybutylhydrazine (PubChem CID 87096241) has the molecular formula C5H14N2O
and a molecular weight of 118.18 g/mol. Its IUPAC name is 3-methoxybutylhydrazine.
Molecular Properties
| Compound Name | 3-methoxybutylhydrazine |
| PubChem CID | 87096241 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 3-methoxybutylhydrazine |
| SMILES | COC(C)CCNN |
| InChI | InChI=1S/C5H14N2O/c1-5(8-2)3-4-7-6/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | NLJHQSADHXYQTK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxybutylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxybutylhydrazine?
The IUPAC name of 3-methoxybutylhydrazine (CID 87096241) is 3-methoxybutylhydrazine.
What is the SMILES notation for 3-methoxybutylhydrazine?
The canonical SMILES for 3-methoxybutylhydrazine is COC(C)CCNN.
What is the InChIKey of 3-methoxybutylhydrazine?
The InChIKey is NLJHQSADHXYQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N2O/c1-5(8-2)3-4-7-6/h5,7H,3-4,6H2,1-2H3.
What are the key properties of 3-methoxybutylhydrazine?
3-methoxybutylhydrazine has a molecular weight of 118.18 g/mol, XLogP of -0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxybutylhydrazine is sourced from PubChem (CID 87096241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).