About dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene (PubChem CID 87096323) has the molecular formula C12H22N2S6
and a molecular weight of 386.72 g/mol. Its IUPAC name is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene.
Molecular Properties
| Compound Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene |
| PubChem CID | 87096323 |
| Molecular Formula | C12H22N2S6 |
| Molecular Weight | 386.72 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene |
| SMILES | C=CCSSCC=C.CN(C)C(=S)SSC(=S)N(C)C |
| InChI | InChI=1S/C6H12N2S4.C6H10S2/c1-7(2)5(9)11-12-6(10)8(3)4;1-3-5-7-8-6-4-2/h1-4H3;3-4H,1-2,5-6H2 |
| InChIKey | QZOHERJAQOMJCZ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.72 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene?
The IUPAC name of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene (CID 87096323) is dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene.
What is the SMILES notation for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene?
The canonical SMILES for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene is C=CCSSCC=C.CN(C)C(=S)SSC(=S)N(C)C.
What is the InChIKey of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene?
The InChIKey is QZOHERJAQOMJCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2S4.C6H10S2/c1-7(2)5(9)11-12-6(10)8(3)4;1-3-5-7-8-6-4-2/h1-4H3;3-4H,1-2,5-6H2.
What are the key properties of dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene?
dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene has a molecular weight of 386.72 g/mol, XLogP of 4.80, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylcarbamothioylsulfanyl N,N-dimethylcarbamodithioate;3-(prop-2-enyldisulfanyl)prop-1-ene is sourced from PubChem (CID 87096323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).