C16H14ClF2N3 — CID 87096347
2-chloro-7-(2,4-difluorophenyl)-N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 87096347) has the molecular formula C16H14ClF2N3 and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-chloro-7-(2,4-difluorophenyl)-N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
| Compound Name | 2-chloro-7-(2,4-difluorophenyl)-N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 87096347 |
| Molecular Formula | C16H14ClF2N3 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-chloro-7-(2,4-difluorophenyl)-N-prop-2-enyl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | C=CCNc1nc(Cl)nc2c1CCC2c1ccc(F)cc1F |
| InChI | InChI=1S/C16H14ClF2N3/c1-2-7-20-15-12-6-5-11(14(12)21-16(17)22-15)10-4-3-9(18)8-13(10)19/h2-4,8,11H,1,5-7H2,(H,20,21,22) |
| InChIKey | BKNDKEXIYLZGTQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|