About boric acid;3-methoxy-2,3-dimethylbutan-2-ol
boric acid;3-methoxy-2,3-dimethylbutan-2-ol (PubChem CID 87096498) has the molecular formula C7H19BO5
and a molecular weight of 194.04 g/mol. Its IUPAC name is boric acid;3-methoxy-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | boric acid;3-methoxy-2,3-dimethylbutan-2-ol |
| PubChem CID | 87096498 |
| Molecular Formula | C7H19BO5 |
| Molecular Weight | 194.04 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | boric acid;3-methoxy-2,3-dimethylbutan-2-ol |
| SMILES | COC(C)(C)C(C)(C)O.OB(O)O |
| InChI | InChI=1S/C7H16O2.BH3O3/c1-6(2,8)7(3,4)9-5;2-1(3)4/h8H,1-5H3;2-4H |
| InChIKey | WWILZZWHWPSZRF-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.04 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;3-methoxy-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;3-methoxy-2,3-dimethylbutan-2-ol?
The IUPAC name of boric acid;3-methoxy-2,3-dimethylbutan-2-ol (CID 87096498) is boric acid;3-methoxy-2,3-dimethylbutan-2-ol.
What is the SMILES notation for boric acid;3-methoxy-2,3-dimethylbutan-2-ol?
The canonical SMILES for boric acid;3-methoxy-2,3-dimethylbutan-2-ol is COC(C)(C)C(C)(C)O.OB(O)O.
What is the InChIKey of boric acid;3-methoxy-2,3-dimethylbutan-2-ol?
The InChIKey is WWILZZWHWPSZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2.BH3O3/c1-6(2,8)7(3,4)9-5;2-1(3)4/h8H,1-5H3;2-4H.
What are the key properties of boric acid;3-methoxy-2,3-dimethylbutan-2-ol?
boric acid;3-methoxy-2,3-dimethylbutan-2-ol has a molecular weight of 194.04 g/mol, XLogP of -0.87, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;3-methoxy-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 87096498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).