About 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid
7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid (PubChem CID 87097230) has the molecular formula C17H15NO6S
and a molecular weight of 361.38 g/mol. Its IUPAC name is 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid.
Molecular Properties
| Compound Name | 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid |
| PubChem CID | 87097230 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid |
| SMILES | COc1cc(OS(=O)(=O)C2CC2)cn2c1c(C(=O)O)c1ccccc12 |
| InChI | InChI=1S/C17H15NO6S/c1-23-14-8-10(24-25(21,22)11-6-7-11)9-18-13-5-3-2-4-12(13)15(16(14)18)17(19)20/h2-5,8-9,11H,6-7H2,1H3,(H,19,20) |
| InChIKey | UKKUVUWWFIVERQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid?
The IUPAC name of 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid (CID 87097230) is 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid.
What is the SMILES notation for 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid?
The canonical SMILES for 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid is COc1cc(OS(=O)(=O)C2CC2)cn2c1c(C(=O)O)c1ccccc12.
What is the InChIKey of 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid?
The InChIKey is UKKUVUWWFIVERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO6S/c1-23-14-8-10(24-25(21,22)11-6-7-11)9-18-13-5-3-2-4-12(13)15(16(14)18)17(19)20/h2-5,8-9,11H,6-7H2,1H3,(H,19,20).
What are the key properties of 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid?
7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid has a molecular weight of 361.38 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropylsulfonyloxy-9-methoxypyrido[1,2-a]indole-10-carboxylic acid is sourced from PubChem (CID 87097230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).