About 1-benzylsulfonyl-2,3-dihydroindole
1-benzylsulfonyl-2,3-dihydroindole (PubChem CID 870979) has the molecular formula C15H15NO2S
and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-benzylsulfonyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-benzylsulfonyl-2,3-dihydroindole |
| PubChem CID | 870979 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-benzylsulfonyl-2,3-dihydroindole |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C15H15NO2S/c17-19(18,12-13-6-2-1-3-7-13)16-11-10-14-8-4-5-9-15(14)16/h1-9H,10-12H2 |
| InChIKey | HEGWNXJQSXOTMK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylsulfonyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylsulfonyl-2,3-dihydroindole?
The IUPAC name of 1-benzylsulfonyl-2,3-dihydroindole (CID 870979) is 1-benzylsulfonyl-2,3-dihydroindole.
What is the SMILES notation for 1-benzylsulfonyl-2,3-dihydroindole?
The canonical SMILES for 1-benzylsulfonyl-2,3-dihydroindole is O=S(=O)(Cc1ccccc1)N1CCc2ccccc21.
What is the InChIKey of 1-benzylsulfonyl-2,3-dihydroindole?
The InChIKey is HEGWNXJQSXOTMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO2S/c17-19(18,12-13-6-2-1-3-7-13)16-11-10-14-8-4-5-9-15(14)16/h1-9H,10-12H2.
What are the key properties of 1-benzylsulfonyl-2,3-dihydroindole?
1-benzylsulfonyl-2,3-dihydroindole has a molecular weight of 273.36 g/mol, XLogP of 2.58, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylsulfonyl-2,3-dihydroindole is sourced from PubChem (CID 870979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).