About 3-[(Z)-octadec-9-enyl]pentane-1,5-diol
3-[(Z)-octadec-9-enyl]pentane-1,5-diol (PubChem CID 87098432) has the molecular formula C23H46O2
and a molecular weight of 354.62 g/mol. Its IUPAC name is 3-[(Z)-octadec-9-enyl]pentane-1,5-diol.
Molecular Properties
| Compound Name | 3-[(Z)-octadec-9-enyl]pentane-1,5-diol |
| PubChem CID | 87098432 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 3-[(Z)-octadec-9-enyl]pentane-1,5-diol |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCO)CCO |
| InChI | InChI=1S/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h9-10,23-25H,2-8,11-22H2,1H3/b10-9- |
| InChIKey | QAXXMWHFMQKBNH-KTKRTIGZSA-N |
| XLogP | 6.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-octadec-9-enyl]pentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The IUPAC name of 3-[(Z)-octadec-9-enyl]pentane-1,5-diol (CID 87098432) is 3-[(Z)-octadec-9-enyl]pentane-1,5-diol.
What is the SMILES notation for 3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The canonical SMILES for 3-[(Z)-octadec-9-enyl]pentane-1,5-diol is CCCCCCCC/C=C\CCCCCCCCC(CCO)CCO.
What is the InChIKey of 3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
The InChIKey is QAXXMWHFMQKBNH-KTKRTIGZSA-N. The full InChI is InChI=1S/C23H46O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23(19-21-24)20-22-25/h9-10,23-25H,2-8,11-22H2,1H3/b10-9-.
What are the key properties of 3-[(Z)-octadec-9-enyl]pentane-1,5-diol?
3-[(Z)-octadec-9-enyl]pentane-1,5-diol has a molecular weight of 354.62 g/mol, XLogP of 6.80, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-octadec-9-enyl]pentane-1,5-diol is sourced from PubChem (CID 87098432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).