C19H19Cl3N2O8 — CID 87098719
2,2,2-trichloroethyl (6S,6aS,8R)-6-hydroxy-2,3-dimethoxy-8-oxaldehydoyl-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate (PubChem CID 87098719) has the molecular formula C19H19Cl3N2O8 and a molecular weight of 509.73 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S,6aS,8R)-6-hydroxy-2,3-dimethoxy-8-oxaldehydoyl-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S,6aS,8R)-6-hydroxy-2,3-dimethoxy-8-oxaldehydoyl-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 87098719 |
| Molecular Formula | C19H19Cl3N2O8 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | 2,2,2-trichloroethyl (6S,6aS,8R)-6-hydroxy-2,3-dimethoxy-8-oxaldehydoyl-11-oxo-6a,7,8,9-tetrahydro-6H-pyrrolo[2,1-c][1,4]benzodiazepine-5-carboxylate |
| SMILES | COc1cc2c(cc1OC)N(C(=O)OCC(Cl)(Cl)Cl)[C@@H](O)[C@@H]1C[C@@H](C(=O)C=O)CN1C2=O |
| InChI | InChI=1S/C19H19Cl3N2O8/c1-30-14-4-10-11(5-15(14)31-2)24(18(29)32-8-19(20,21)22)17(28)12-3-9(13(26)7-25)6-23(12)16(10)27/h4-5,7,9,12,17,28H,3,6,8H2,1-2H3/t9-,12+,17+/m1/s1 |
| InChIKey | HUFDCIJOISUMLB-ZPQPFTAQSA-N |
| XLogP | 1.95 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|