About heptane-3,4,5-triamine;bis(prop-2-enamide)
heptane-3,4,5-triamine;bis(prop-2-enamide) (PubChem CID 87098922) has the molecular formula C13H29N5O2
and a molecular weight of 287.41 g/mol. Its IUPAC name is heptane-3,4,5-triamine;bis(prop-2-enamide).
Molecular Properties
| Compound Name | heptane-3,4,5-triamine;bis(prop-2-enamide) |
| PubChem CID | 87098922 |
| Molecular Formula | C13H29N5O2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | heptane-3,4,5-triamine;bis(prop-2-enamide) |
| SMILES | C=CC(N)=O.C=CC(N)=O.CCC(N)C(N)C(N)CC |
| InChI | InChI=1S/C7H19N3.2C3H5NO/c1-3-5(8)7(10)6(9)4-2;2*1-2-3(4)5/h5-7H,3-4,8-10H2,1-2H3;2*2H,1H2,(H2,4,5) |
| InChIKey | KUCYGMGMBUEODY-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 164.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze heptane-3,4,5-triamine;bis(prop-2-enamide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptane-3,4,5-triamine;bis(prop-2-enamide)?
The IUPAC name of heptane-3,4,5-triamine;bis(prop-2-enamide) (CID 87098922) is heptane-3,4,5-triamine;bis(prop-2-enamide).
What is the SMILES notation for heptane-3,4,5-triamine;bis(prop-2-enamide)?
The canonical SMILES for heptane-3,4,5-triamine;bis(prop-2-enamide) is C=CC(N)=O.C=CC(N)=O.CCC(N)C(N)C(N)CC.
What is the InChIKey of heptane-3,4,5-triamine;bis(prop-2-enamide)?
The InChIKey is KUCYGMGMBUEODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H19N3.2C3H5NO/c1-3-5(8)7(10)6(9)4-2;2*1-2-3(4)5/h5-7H,3-4,8-10H2,1-2H3;2*2H,1H2,(H2,4,5).
What are the key properties of heptane-3,4,5-triamine;bis(prop-2-enamide)?
heptane-3,4,5-triamine;bis(prop-2-enamide) has a molecular weight of 287.41 g/mol, XLogP of -0.90, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for heptane-3,4,5-triamine;bis(prop-2-enamide) is sourced from PubChem (CID 87098922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).