2-(2-adamantyl)acetic acid

C12H18O2 — CID 870990

IUPAC2-(2-adamantyl)acetic acid
SMILESO=C(O)CC1C2CC3CC(C2)CC1C3
InChIInChI=1S/C12H18O2/c13-12(14)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6H2,(H,13,14)
InChIKeyKVBKBENCOHRLFW-UHFFFAOYSA-N
MW194.27 g/mol
LogP2.53
Rot. Bonds2

About 2-(2-adamantyl)acetic acid

2-(2-adamantyl)acetic acid (PubChem CID 870990) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(2-adamantyl)acetic acid.

Molecular Properties

Compound Name2-(2-adamantyl)acetic acid
PubChem CID870990
Molecular FormulaC12H18O2
Molecular Weight194.27 g/mol
Exact Mass194.13
IUPAC Name2-(2-adamantyl)acetic acid
SMILESO=C(O)CC1C2CC3CC(C2)CC1C3
InChIInChI=1S/C12H18O2/c13-12(14)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6H2,(H,13,14)
InChIKeyKVBKBENCOHRLFW-UHFFFAOYSA-N
XLogP2.53
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.27
LogP ≤ 52.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2-adamantyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-adamantyl)acetic acid?
The IUPAC name of 2-(2-adamantyl)acetic acid (CID 870990) is 2-(2-adamantyl)acetic acid.
What is the SMILES notation for 2-(2-adamantyl)acetic acid?
The canonical SMILES for 2-(2-adamantyl)acetic acid is O=C(O)CC1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-(2-adamantyl)acetic acid?
The InChIKey is KVBKBENCOHRLFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2/c13-12(14)6-11-9-2-7-1-8(4-9)5-10(11)3-7/h7-11H,1-6H2,(H,13,14).
What are the key properties of 2-(2-adamantyl)acetic acid?
2-(2-adamantyl)acetic acid has a molecular weight of 194.27 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-adamantyl)acetic acid is sourced from PubChem (CID 870990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).