About CID 87099045
CID 87099045 (PubChem CID 87099045) has the molecular formula C5H9OSi
and a molecular weight of 113.21 g/mol.
Molecular Properties
| Compound Name | CID 87099045 |
| PubChem CID | 87099045 |
| Molecular Formula | C5H9OSi |
| Molecular Weight | 113.21 g/mol |
| Exact Mass | 113.04 |
| IUPAC Name | — |
| SMILES | C=CC(=O)[Si](C)C |
| InChI | InChI=1S/C5H9OSi/c1-4-5(6)7(2)3/h4H,1H2,2-3H3 |
| InChIKey | ZJNRMEMSCACOBL-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 87099045 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87099045?
The IUPAC name of CID 87099045 (CID 87099045) is not available.
What is the SMILES notation for CID 87099045?
The canonical SMILES for CID 87099045 is C=CC(=O)[Si](C)C.
What is the InChIKey of CID 87099045?
The InChIKey is ZJNRMEMSCACOBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9OSi/c1-4-5(6)7(2)3/h4H,1H2,2-3H3.
What are the key properties of CID 87099045?
CID 87099045 has a molecular weight of 113.21 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87099045 is sourced from PubChem (CID 87099045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).