C16H13N3O3 — CID 87099262
1'-methyl-2',5'-dioxospiro[6,8-dihydrocyclopenta[g]quinoline-7,4'-imidazolidine]-2-carbaldehyde (PubChem CID 87099262) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1'-methyl-2',5'-dioxospiro[6,8-dihydrocyclopenta[g]quinoline-7,4'-imidazolidine]-2-carbaldehyde.
| Compound Name | 1'-methyl-2',5'-dioxospiro[6,8-dihydrocyclopenta[g]quinoline-7,4'-imidazolidine]-2-carbaldehyde |
|---|---|
| PubChem CID | 87099262 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1'-methyl-2',5'-dioxospiro[6,8-dihydrocyclopenta[g]quinoline-7,4'-imidazolidine]-2-carbaldehyde |
| SMILES | CN1C(=O)NC2(Cc3cc4ccc(C=O)nc4cc3C2)C1=O |
| InChI | InChI=1S/C16H13N3O3/c1-19-14(21)16(18-15(19)22)6-10-4-9-2-3-12(8-20)17-13(9)5-11(10)7-16/h2-5,8H,6-7H2,1H3,(H,18,22) |
| InChIKey | OIDGMAZGMIQQGE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|