C30H30O15 — CID 87099268
6-[2,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-2,5-diene-1-carbonyl]oxycarbonyl-3-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,4-diene-1,3-dicarboxylic acid (PubChem CID 87099268) has the molecular formula C30H30O15 and a molecular weight of 630.55 g/mol. Its IUPAC name is 6-[2,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-2,5-diene-1-carbonyl]oxycarbonyl-3-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,4-diene-1,3-dicarboxylic acid.
| Compound Name | 6-[2,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-2,5-diene-1-carbonyl]oxycarbonyl-3-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,4-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87099268 |
| Molecular Formula | C30H30O15 |
| Molecular Weight | 630.55 g/mol |
| Exact Mass | 630.16 |
| IUPAC Name | 6-[2,4-dicarboxy-4-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-2,5-diene-1-carbonyl]oxycarbonyl-3-[1-(2-methylprop-2-enoyloxy)ethyl]cyclohexa-1,4-diene-1,3-dicarboxylic acid |
| SMILES | C=C(C)C(=O)OC(C)C1(C(=O)O)C=CC(C(=O)OC(=O)C2C=CC(C(=O)O)(C(C)OC(=O)C(=C)C)C=C2C(=O)O)C(C(=O)O)=C1 |
| InChI | InChI=1S/C30H30O15/c1-13(2)23(35)43-15(5)29(27(39)40)9-7-17(19(11-29)21(31)32)25(37)45-26(38)18-8-10-30(28(41)42,12-20(18)22(33)34)16(6)44-24(36)14(3)4/h7-12,15-18H,1,3H2,2,4-6H3,(H,31,32)(H,33,34)(H,39,40)(H,41,42) |
| InChIKey | FBQDBRHZEZXRPO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 245.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|