About 1,3-thiazole-1,3-dicarboxylic acid
1,3-thiazole-1,3-dicarboxylic acid (PubChem CID 87099480) has the molecular formula C5H5NO4S
and a molecular weight of 175.16 g/mol. Its IUPAC name is 1,3-thiazole-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 1,3-thiazole-1,3-dicarboxylic acid |
| PubChem CID | 87099480 |
| Molecular Formula | C5H5NO4S |
| Molecular Weight | 175.16 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 1,3-thiazole-1,3-dicarboxylic acid |
| SMILES | O=C(O)N1C=CS(C(=O)O)=C1 |
| InChI | InChI=1S/C5H5NO4S/c7-4(8)6-1-2-11(3-6)5(9)10/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | BZFHAUOSGASVGS-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 1,3-thiazole-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazole-1,3-dicarboxylic acid?
The IUPAC name of 1,3-thiazole-1,3-dicarboxylic acid (CID 87099480) is 1,3-thiazole-1,3-dicarboxylic acid.
What is the SMILES notation for 1,3-thiazole-1,3-dicarboxylic acid?
The canonical SMILES for 1,3-thiazole-1,3-dicarboxylic acid is O=C(O)N1C=CS(C(=O)O)=C1.
What is the InChIKey of 1,3-thiazole-1,3-dicarboxylic acid?
The InChIKey is BZFHAUOSGASVGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO4S/c7-4(8)6-1-2-11(3-6)5(9)10/h1-3H,(H,7,8)(H,9,10).
What are the key properties of 1,3-thiazole-1,3-dicarboxylic acid?
1,3-thiazole-1,3-dicarboxylic acid has a molecular weight of 175.16 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazole-1,3-dicarboxylic acid is sourced from PubChem (CID 87099480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).