C21H29FN6O4 — CID 87099796
3-acetamido-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid (PubChem CID 87099796) has the molecular formula C21H29FN6O4 and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-acetamido-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-acetamido-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 87099796 |
| Molecular Formula | C21H29FN6O4 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | 3-acetamido-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]propanoic acid |
| SMILES | CC(=O)NC(CC(=O)O)NC(=O)c1ccc(N2CCC(NC3=NCCCN3)CC2)c(F)c1 |
| InChI | InChI=1S/C21H29FN6O4/c1-13(29)25-18(12-19(30)31)27-20(32)14-3-4-17(16(22)11-14)28-9-5-15(6-10-28)26-21-23-7-2-8-24-21/h3-4,11,15,18H,2,5-10,12H2,1H3,(H,25,29)(H,27,32)(H,30,31)(H2,23,24,26) |
| InChIKey | SMYJEYRNJBRIEB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 135.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|