C20H20F7NO4S — CID 87100246
[(2,2,3,3,4,4,4-heptafluoro-1-phenylbutylidene)amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate (PubChem CID 87100246) has the molecular formula C20H20F7NO4S and a molecular weight of 503.44 g/mol. Its IUPAC name is [(2,2,3,3,4,4,4-heptafluoro-1-phenylbutylidene)amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate.
| Compound Name | [(2,2,3,3,4,4,4-heptafluoro-1-phenylbutylidene)amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
|---|---|
| PubChem CID | 87100246 |
| Molecular Formula | C20H20F7NO4S |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [(2,2,3,3,4,4,4-heptafluoro-1-phenylbutylidene)amino] (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonate |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)ON=C(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F)C(=O)C2 |
| InChI | InChI=1S/C20H20F7NO4S/c1-16(2)13-8-9-17(16,14(29)10-13)11-33(30,31)32-28-15(12-6-4-3-5-7-12)18(21,22)19(23,24)20(25,26)27/h3-7,13H,8-11H2,1-2H3 |
| InChIKey | RPIZDEOUYPBZHP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|