C15H8F5NO4 — CID 8710084
(2,3,4,5,6-pentafluorophenyl)methyl 2-methyl-3-nitrobenzoate (PubChem CID 8710084) has the molecular formula C15H8F5NO4 and a molecular weight of 361.22 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methyl 2-methyl-3-nitrobenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 8710084 |
| Molecular Formula | C15H8F5NO4 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methyl 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H8F5NO4/c1-6-7(3-2-4-9(6)21(23)24)15(22)25-5-8-10(16)12(18)14(20)13(19)11(8)17/h2-4H,5H2,1H3 |
| InChIKey | KYOAONSARPVNFV-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|